2,5-Dimethyl-4-methoxyphenylboronic acid, 97%
cas: 246023-54-1 — see every product listed under this CAS number, including other names
2,5-Dimethyl-4-methoxyphenylboronic acid, 97% (CAS 246023-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A278450-250mg |
| cas | 246023-54-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1021.19 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 616.40 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 375.45 Pln | |
| BLDpharm | 25g | 1097.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-methoxy-2,5-dimethylphenyl)boronic acid (CAS 246023-54-1) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,5-dimethylphenyl)boronic acid. InChIKey: IUUWNGBWUJVQCF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,5-dimethylphenyl)boronic acid |
| InChIKey | IUUWNGBWUJVQCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dimethyl-4-methoxyphenylboronic acid, 4-Methoxy-2,5-dimethylphenylboronic acid, (4-methoxy-2,5-dimethylphenyl)boronic acid, Boronic acid, B-(4-methoxy-2,5-dimethylphenyl)-, Boronic acid, (4-methoxy-2,5-dimethylphenyl)-, 2,5-Dimethyl-4-methoxyphenylboronicacid, (4-methoxy-2,5-dimethyl-phenyl)boronic Acid, IUUWNGBWUJVQCF-UHFFFAOYSA-N, 2,5-dimethyl-4-methoxy-phenylboronic acid, 4-Methoxy-2,5-dimethylbenzeneboronic Acid
