cas: 246023-54-1 — see every product listed under this CAS number, including other names
4-Methoxy-2,5-dimethylphenylboronic Acid (contains varying amounts of Anhydride) (CAS 246023-54-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2838-1G |
| cas | 246023-54-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 364.21 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(4-methoxy-2,5-dimethylphenyl)boronic acid (CAS 246023-54-1) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,5-dimethylphenyl)boronic acid. InChIKey: IUUWNGBWUJVQCF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,5-dimethylphenyl)boronic acid |
| InChIKey | IUUWNGBWUJVQCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)