cas: 83141-10-0 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-nitrobenzoic acid, 98%, 98% (CAS 83141-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G5A-1g |
| cas | 83141-10-0 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 318.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-difluoro-3-nitrobenzoic acid (CAS 83141-10-0) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,6-difluoro-3-nitrobenzoic acid. InChIKey: PDDHSNODMFIIRV-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,6-difluoro-3-nitrobenzoic acid |
| InChIKey | PDDHSNODMFIIRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)O)F |
Computed by PubChem (NCBI)