2,6-Difluoro-3-nitrobenzoic acid, 98%
cas: 83141-10-0 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-nitrobenzoic acid, 98% (CAS 83141-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033074-1G |
| cas | 83141-10-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 487.35 Pln | |
| Fluorochem | 500g | 2215.90 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,6-difluoro-3-nitrobenzoic acid (CAS 83141-10-0) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,6-difluoro-3-nitrobenzoic acid. InChIKey: PDDHSNODMFIIRV-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,6-difluoro-3-nitrobenzoic acid |
| InChIKey | PDDHSNODMFIIRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)O)F |
Computed by PubChem (NCBI)