cas: 613-77-4 — see every product listed under this CAS number, including other names
2,7-Dichloroquinoline, 98% (CAS 613-77-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A852348-10g |
| cas | 613-77-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16149.70 Pln | |
| AmBeed | 5g | 11469.01 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 500mg | 1434.93 Pln | |
| Fluorochem | 1g | 2189.87 Pln | |
| Fluorochem | 2.5g | 4064.21 Pln | |
| Fluorochem | 5g | 6480.03 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,7-dichloroquinoline (CAS 613-77-4) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 2,7-dichloroquinoline. InChIKey: VOGBOMUONXLUTI-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 2,7-dichloroquinoline |
| InChIKey | VOGBOMUONXLUTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)