cas: 67092-20-0 — see every product listed under this CAS number, including other names
2,8-Dichloroquinazoline 97% (CAS 67092-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158671-100mg |
| cas | 67092-20-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 826.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A158671 |
2,8-dichloroquinazoline (CAS 67092-20-0) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloroquinazoline. InChIKey: JLCHUDPERPLJPI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloroquinazoline |
| InChIKey | JLCHUDPERPLJPI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)