cas: 67092-20-0 — see every product listed under this CAS number, including other names
2,8-Dichloroquinazoline, 98%, 98% (CAS 67092-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117M5C-100mg |
| cas | 67092-20-0 |
| size | 100mg |
| availability | 3.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 510.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,8-dichloroquinazoline (CAS 67092-20-0) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloroquinazoline. InChIKey: JLCHUDPERPLJPI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloroquinazoline |
| InChIKey | JLCHUDPERPLJPI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)