cas: 1780785-72-9 — see every product listed under this CAS number, including other names
2-(2-Bromo-3,4-difluorophenyl)acetic acid, 98%, 98% (CAS 1780785-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136QZ-100mg |
| cas | 1780785-72-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2646.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-bromo-3,4-difluorophenyl)acetic acid (CAS 1780785-72-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(2-bromo-3,4-difluorophenyl)acetic acid. InChIKey: NYGFDSVWTYZHQM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(2-bromo-3,4-difluorophenyl)acetic acid |
| InChIKey | NYGFDSVWTYZHQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)Br)F)F |
Computed by PubChem (NCBI)