CAS 2404734-15-0 appears in our catalog under these names: 5-Bromo-2,4-difluoro-3-methylbenzoic acid, 95%, 5-Bromo-2,4-difluoro-3-methylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-2,4-difluoro-3-methylbenzoic acid (CAS 2404734-15-0) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 5-bromo-2,4-difluoro-3-methylbenzoic acid. InChIKey: KMVMOIZGQOWOHS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 5-bromo-2,4-difluoro-3-methylbenzoic acid |
| InChIKey | KMVMOIZGQOWOHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)Br)C(=O)O)F |
Computed by PubChem (NCBI)