cas: 885068-76-8 — see every product listed under this CAS number, including other names
2-(3-BROMOPHENYL)-2,2-DIFLUOROACETIC ACID, 96% (CAS 885068-76-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532050-100MG |
| cas | 885068-76-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 5g | 1528.65 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-bromophenyl)-2,2-difluoroacetic acid (CAS 885068-76-8) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(3-bromophenyl)-2,2-difluoroacetic acid. InChIKey: CYIBFFJUPHCMOO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2,2-difluoroacetic acid |
| InChIKey | CYIBFFJUPHCMOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)