cas: 1261566-57-7 — see every product listed under this CAS number, including other names
2-Bromo-3-methylbenzenesulfonyl chloride, 98% (CAS 1261566-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A590694-100mg |
| cas | 1261566-57-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 603.82 Pln | |
| AmBeed | 10g | 8448.37 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-3-methylbenzenesulfonyl chloride (CAS 1261566-57-7) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-3-methylbenzenesulfonyl chloride. InChIKey: PIFIURZNLONQND-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-3-methylbenzenesulfonyl chloride |
| InChIKey | PIFIURZNLONQND-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)