cas: 1036389-83-9 — see every product listed under this CAS number, including other names
2-Bromo-4-fluoro-5-nitrobenzoic acid, 95% (CAS 1036389-83-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450595-250MG |
| cas | 1036389-83-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 732.05 Pln | |
| Fluorochem | 10g | 1382.86 Pln | |
| Fluorochem | 25g | 2450.20 Pln | |
| Fluorochem | 100g | 7693.14 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-fluoro-5-nitrobenzoic acid (CAS 1036389-83-9) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-4-fluoro-5-nitrobenzoic acid. InChIKey: APETYHSLTIVOQX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-5-nitrobenzoic acid |
| InChIKey | APETYHSLTIVOQX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)Br)C(=O)O |
Computed by PubChem (NCBI)