Products 1249531-65-4

CAS 1249531-65-4 is the registry number for 4-Bromo-3-fluoro-5-nitrobenzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-3-fluoro-5-nitrobenzoic acid (CAS 1249531-65-4) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-3-fluoro-5-nitrobenzoic acid. InChIKey: VNBUOQRPHGBTIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrFNO4
Molecular weight264.00 g/mol
IUPAC name4-bromo-3-fluoro-5-nitrobenzoic acid
InChIKeyVNBUOQRPHGBTIQ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])Br)F)C(=O)O

Computed by PubChem (NCBI)