CAS 1249531-65-4 is the registry number for 4-Bromo-3-fluoro-5-nitrobenzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 0,5g.
4-bromo-3-fluoro-5-nitrobenzoic acid (CAS 1249531-65-4) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-3-fluoro-5-nitrobenzoic acid. InChIKey: VNBUOQRPHGBTIQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-3-fluoro-5-nitrobenzoic acid |
| InChIKey | VNBUOQRPHGBTIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Br)F)C(=O)O |
Computed by PubChem (NCBI)