CAS 1805189-72-3 appears in our catalog under these names: 2–Bromo–5–fluoro–4–nitrobenzoic acid, 2-Bromo-5-fluoro-4-nitrobenzoic acid 97%, Benzoic acid, 2-bromo-5-fluoro-4-nitro-, 97%, 97%, 2-BROMO-5-FLUORO-4-NITROBENZOIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-bromo-5-fluoro-4-nitrobenzoic acid (CAS 1805189-72-3) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-5-fluoro-4-nitrobenzoic acid. InChIKey: YHWXPVUSPPRQLC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-nitrobenzoic acid |
| InChIKey | YHWXPVUSPPRQLC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)