CAS 1036388-83-6 appears in our catalog under these names: 6-Bromo-2-fluoro-3-nitrobenzoic acid, 98%, 6-Bromo-2-fluoro-3-nitrobenzoic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
6-bromo-2-fluoro-3-nitrobenzoic acid (CAS 1036388-83-6) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 6-bromo-2-fluoro-3-nitrobenzoic acid. InChIKey: WFIRQCWYKQBBEX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-nitrobenzoic acid |
| InChIKey | WFIRQCWYKQBBEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)O)Br |
Computed by PubChem (NCBI)