cas: 141113-98-6 — see every product listed under this CAS number, including other names
2-Bromo-5-methylbenzenesulfonyl chloride, 98% (CAS 141113-98-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037985-50MG |
| cas | 141113-98-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 247.85 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 500mg | 758.08 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 2.5g | 2153.43 Pln | |
| Fluorochem | 5g | 2986.47 Pln | |
| Fluorochem | 10g | 4944.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-methylbenzenesulfonyl chloride (CAS 141113-98-6) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-5-methylbenzenesulfonyl chloride. InChIKey: ZFCDMNSVQJUZTG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-5-methylbenzenesulfonyl chloride |
| InChIKey | ZFCDMNSVQJUZTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)