Products 1803729-19-2
CAS 1803729-19-2 appears in our catalog under these names: Moxifloxacin Impurity 58, Moxifloxacin Impurity 104. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-difluoro-5-hydroxybenzoyl chloride (CAS 1803729-19-2) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 3,4-difluoro-5-hydroxybenzoyl chloride. InChIKey: VJWQXOLIMBRBML-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 3,4-difluoro-5-hydroxybenzoyl chloride |
| InChIKey | VJWQXOLIMBRBML-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)F)C(=O)Cl |
Computed by PubChem (NCBI)