CAS 287172-74-1 appears in our catalog under these names: 2–Chloro–3,6–Difluorobenzoic Acid, 2-Chloro-3,6-difluorobenzoic acid 98%, 2-Chloro-3,6-Difluorobenzoic Acid, 98%, 98%, 2-Chloro-3,6-difluorobenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 500g, 10g.
2-chloro-3,6-difluorobenzoic acid (CAS 287172-74-1) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-3,6-difluorobenzoic acid. InChIKey: COWJYTLVSFKOPM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-3,6-difluorobenzoic acid |
| InChIKey | COWJYTLVSFKOPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)Cl)F |
Computed by PubChem (NCBI)