CAS 154257-75-7 appears in our catalog under these names: 3-Chloro-2,4-difluorobenzoic Acid, >98.0%(GC)(T), 3-Chloro-2,4-difluorobenzoic acid 98%, 3-Chloro-2,4-difluorobenzoic acid, 97%, 97%, 3-Chloro-2,4-difluorobenzoic acid, 99.94%, 3-Chloro-2,4-difluorobenzoic acid, 97%. Offered by: TCI, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 25 g, 10 g.
3-chloro-2,4-difluorobenzoic acid (CAS 154257-75-7) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzoic acid. InChIKey: YGYZTZAEZMCPSC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzoic acid |
| InChIKey | YGYZTZAEZMCPSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)Cl)F |
Computed by PubChem (NCBI)