Products 887584-84-1
CAS 887584-84-1 appears in our catalog under these names: 6-Chloro-2,3-difluorobenzoic acid, 96%, 6-Chloro-2,3-difluorobenzoic acid, 6-Chloro-2,3-difluorobenzoic acid 96%, 6-Chloro-2,3-difluorobenzoic acid, 97%, 97%, 6-Chloro-2,3-difluorobenzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 250mg, 100mg.
6-chloro-2,3-difluorobenzoic acid (CAS 887584-84-1) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 6-chloro-2,3-difluorobenzoic acid. InChIKey: MJWXJSUYTVBLJU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 6-chloro-2,3-difluorobenzoic acid |
| InChIKey | MJWXJSUYTVBLJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)