Products 150444-95-4
CAS 150444-95-4 appears in our catalog under these names: 3-Chloro-4,5-difluorobenzoic acid, 95%, 3–Chloro–4，5–difluorobenzoic acid, 3-Chloro-4,5-difluorobenzoic acid 96%, 3-Chloro-4,5-difluorobenzoic acid, 97%, 97%, 3-Chloro-4,5-difluoro-benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
3-chloro-4,5-difluorobenzoic acid (CAS 150444-95-4) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 3-chloro-4,5-difluorobenzoic acid. InChIKey: RRJYBDSJDKWHOS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 3-chloro-4,5-difluorobenzoic acid |
| InChIKey | RRJYBDSJDKWHOS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)