CAS 130025-33-1 appears in our catalog under these names: 5-Chloro-2,4-difluorobenzoic acid 97%, 5-Chloro-2,4-difluorobenzoic acid, 97%, 97%, 5-Chloro-2,4-difluorobenzoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
5-chloro-2,4-difluorobenzoic acid (CAS 130025-33-1) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 5-chloro-2,4-difluorobenzoic acid. InChIKey: VXBQLSVFGIFOPQ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 5-chloro-2,4-difluorobenzoic acid |
| InChIKey | VXBQLSVFGIFOPQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)F)C(=O)O |
Computed by PubChem (NCBI)