Products 1242339-67-8
CAS 1242339-67-8 appears in our catalog under these names: 2–Chloro–4，6–difluorobenzoic acid, 2-Chloro-4,6-difluorobenzoic acid, 2-Chloro-4,6-difluorobenzoic acid 97%, 2-chloro-4,6-difluorobenzoic acid, 97%, 97%, 2-Chloro-4,6-difluorobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2g, 25g, 50g, 100mg, 250mg.
2-chloro-4,6-difluorobenzoic acid (CAS 1242339-67-8) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-4,6-difluorobenzoic acid. InChIKey: SHCCCLQAWAYTLM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-4,6-difluorobenzoic acid |
| InChIKey | SHCCCLQAWAYTLM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Cl)F |
Computed by PubChem (NCBI)