CAS 1516039-72-7 is the registry number for 2,6-Difluorophenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,6-difluorophenyl) carbonochloridate (CAS 1516039-72-7) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: (2,6-difluorophenyl) carbonochloridate. InChIKey: XAEAQCLRHNJBLT-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | (2,6-difluorophenyl) carbonochloridate |
| InChIKey | XAEAQCLRHNJBLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(=O)Cl)F |
Computed by PubChem (NCBI)