cas: 950662-22-3 — see every product listed under this CAS number, including other names
2-Chloro-4,5-dimethoxyphenylboronic acid, 98%, 98% (CAS 950662-22-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIPL-50mg |
| cas | 950662-22-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 100mg | 227.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-4,5-dimethoxyphenyl)boronic acid (CAS 950662-22-3) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (2-chloro-4,5-dimethoxyphenyl)boronic acid. InChIKey: NSVSDBMTEFWBQY-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (2-chloro-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | NSVSDBMTEFWBQY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)