Products 76286-03-8
CAS 76286-03-8 is the registry number for 2-Chloro-4-trifluoromethylbenzoyl chloride. Offered by: Fluorochem. Available pack sizes: 1g.
2-chloro-4-(trifluoromethyl)benzoyl chloride (CAS 76286-03-8) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)benzoyl chloride. InChIKey: OCLDSIAHVMNJMC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)benzoyl chloride |
| InChIKey | OCLDSIAHVMNJMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)