CAS 130336-16-2 appears in our catalog under these names: 3',5'-Dichloro-2,2,2-trifluoroacetophenone, >95% (HPLC), 3',5'–Dichloro–2,2,2–trifluoroacetophenone, 1-(3,5-Dichlorophenyl)-2,2,2-trifluoroethanone, 3',5'-Dichloro-2,2,2-trifluoroacetophenone, >96.0%(GC), 1-(3,5-Dichlorophenyl)-2,2,2-trifluoroethanone 95%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 50g, 100mg, 250mg, 10g, 100g.
1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone (CAS 130336-16-2) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone. InChIKey: DZDSQRPDUCSOQV-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | DZDSQRPDUCSOQV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)