cas: 16670-48-7 — see every product listed under this CAS number, including other names
2-Chloroethyl Benzenesulfonate, >98.0%(GC) (CAS 16670-48-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2230-5G |
| cas | 16670-48-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 428.13 Pln | |
| TCI | 25g | 1608.27 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-chloroethyl benzenesulfonate (CAS 16670-48-7) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-chloroethyl benzenesulfonate. InChIKey: CIIGWOXXOUVEAD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-chloroethyl benzenesulfonate |
| InChIKey | CIIGWOXXOUVEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCCCl |
Computed by PubChem (NCBI)