cas: 16670-48-7 — see every product listed under this CAS number, including other names
2-Chloroethyl benzenesulfonate (CAS 16670-48-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F770782-1G |
| cas | 16670-48-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 700.81 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloroethyl benzenesulfonate (CAS 16670-48-7) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-chloroethyl benzenesulfonate. InChIKey: CIIGWOXXOUVEAD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-chloroethyl benzenesulfonate |
| InChIKey | CIIGWOXXOUVEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCCCl |
Computed by PubChem (NCBI)