cas: 68800-33-9 — see every product listed under this CAS number, including other names
2-Ethoxybenzene-1-sulfonyl chloride 95+% (CAS 68800-33-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114918-250mg |
| cas | 68800-33-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A114918 |
2-ethoxybenzenesulfonyl chloride (CAS 68800-33-9) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-ethoxybenzenesulfonyl chloride. InChIKey: RWURYJNJYODVAL-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-ethoxybenzenesulfonyl chloride |
| InChIKey | RWURYJNJYODVAL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)