cas: 68800-33-9 — see every product listed under this CAS number, including other names
2-Ethoxybenzenesulfonyl chloride, 95+%, 95+% (CAS 68800-33-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116NZM-250mg |
| cas | 68800-33-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 1686.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-ethoxybenzenesulfonyl chloride (CAS 68800-33-9) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-ethoxybenzenesulfonyl chloride. InChIKey: RWURYJNJYODVAL-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-ethoxybenzenesulfonyl chloride |
| InChIKey | RWURYJNJYODVAL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)