CAS 68800-33-9 appears in our catalog under these names: 2-Ethoxybenzenesulfonyl chloride, 97%, 2-Ethoxybenzenesulfonyl chloride, 96% , 2-ethoxybenzenesulfonyl chloride, 2-Ethoxybenzenesulfonyl chloride, 95+%, 95+%, 2-Ethoxybenzene-1-sulfonyl chloride, 96%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2g, 250mg.
2-ethoxybenzenesulfonyl chloride (CAS 68800-33-9) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-ethoxybenzenesulfonyl chloride. InChIKey: RWURYJNJYODVAL-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-ethoxybenzenesulfonyl chloride |
| InChIKey | RWURYJNJYODVAL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)