cas: 54903-16-1 — see every product listed under this CAS number, including other names
2-Oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylic acid 95% (CAS 54903-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A548869-100mg |
| cas | 54903-16-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1516.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A548869 |
2-oxo-3H-1,3-benzoxazole-6-carboxylic acid (CAS 54903-16-1) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid. InChIKey: BZRKWTCIDCRBMY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | BZRKWTCIDCRBMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=O)N2 |
Computed by PubChem (NCBI)