cas: 54903-16-1 — see every product listed under this CAS number, including other names
2-Oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylic acid, 95%, 95% (CAS 54903-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCLT-100mg |
| cas | 54903-16-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 952.40 Pln | |
| Chemat | 10g | 1845.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-oxo-3H-1,3-benzoxazole-6-carboxylic acid (CAS 54903-16-1) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid. InChIKey: BZRKWTCIDCRBMY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | BZRKWTCIDCRBMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=O)N2 |
Computed by PubChem (NCBI)