cas: 1686130-35-7 — see every product listed under this CAS number, including other names
3,4-Dichloro-5-(trifluoromethyl)benzaldehyde, 95%, 95% (CAS 1686130-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FGO3-100mg |
| cas | 1686130-35-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1384.40 Pln | |
| Chemat | 1g | 3741.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,4-dichloro-5-(trifluoromethyl)benzaldehyde (CAS 1686130-35-7) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzaldehyde. InChIKey: JUPNFMGKWKVUBY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | JUPNFMGKWKVUBY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C=O |
Computed by PubChem (NCBI)