cas: 1121583-51-4 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-nitrobenzoic acid, 95%, 95% (CAS 1121583-51-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119ULD-100mg |
| cas | 1121583-51-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1648.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,4-difluoro-5-nitrobenzoic acid (CAS 1121583-51-4) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,4-difluoro-5-nitrobenzoic acid. InChIKey: QEGLWOZIWGKZJI-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 3,4-difluoro-5-nitrobenzoic acid |
| InChIKey | QEGLWOZIWGKZJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)F)C(=O)O |
Computed by PubChem (NCBI)