cas: 1121583-51-4 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-nitrobenzoic acid, 97% (CAS 1121583-51-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F612744-250MG |
| cas | 1121583-51-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 1g | 2283.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3,4-difluoro-5-nitrobenzoic acid (CAS 1121583-51-4) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,4-difluoro-5-nitrobenzoic acid. InChIKey: QEGLWOZIWGKZJI-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 3,4-difluoro-5-nitrobenzoic acid |
| InChIKey | QEGLWOZIWGKZJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)F)C(=O)O |
Computed by PubChem (NCBI)