cas: 420846-72-6 — see every product listed under this CAS number, including other names
3–((4–oxo–3,4–dihydrophthalazin–1–yl)methyl)benzoicacid (CAS 420846-72-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF34061-10g |
| cas | 420846-72-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 6653.61 Pln | |
| GLPBio | 1g | 1734.40 Pln | |
| GLPBio | 250mg | 919.99 Pln | |
| GLPBio | 5g | 4107.41 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 420846-72-6) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: LOEQJTGFMWZFBM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | LOEQJTGFMWZFBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)