cas: 420846-72-6 — see every product listed under this CAS number, including other names
3-[(3,4-Dihydro-4-oxo-1-phthalazinyl)methyl]benzoic acid, 98%, 98% (CAS 420846-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8SX-100mg |
| cas | 420846-72-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 420846-72-6) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: LOEQJTGFMWZFBM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | LOEQJTGFMWZFBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)