cas: 420846-72-6 — see every product listed under this CAS number, including other names
3-((4-Oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid, 98% (CAS 420846-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333143-100MG |
| cas | 420846-72-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1731.70 Pln | |
| Fluorochem | 5g | 4704.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 420846-72-6) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: LOEQJTGFMWZFBM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | LOEQJTGFMWZFBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)