cas: 338982-11-9 — see every product listed under this CAS number, including other names
3-(4-Chlorophenyl)isoxazole-5-carboxylic acid 95% (CAS 338982-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233943-100mg |
| cas | 338982-11-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1049.00 Pln | |
| Ambeed | 5g | 4825.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A233943 |
3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 338982-11-9) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: COIATTMFFQMKKS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | COIATTMFFQMKKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)