cas: 338982-11-9 — see every product listed under this CAS number, including other names
3-(4-Chlorophenyl)isoxazole-5-carboxylic acid, 95%, 95% (CAS 338982-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CR7T-100mg |
| cas | 338982-11-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 3712.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 338982-11-9) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: COIATTMFFQMKKS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | COIATTMFFQMKKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)