cas: 6968-22-5 — see every product listed under this CAS number, including other names
3-Amino-4-nitrobenzoic acid 95% (CAS 6968-22-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A263155-250mg |
| cas | 6968-22-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 10g | 1299.31 Pln | |
| Ambeed | 25g | 2417.38 Pln | |
| Ambeed | 100g | 7579.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A263155 |
3-amino-4-nitrobenzoic acid (CAS 6968-22-5) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-4-nitrobenzoic acid. InChIKey: LYCCVBLUKJRDOF-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-4-nitrobenzoic acid |
| InChIKey | LYCCVBLUKJRDOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)