cas: 886501-61-7 — see every product listed under this CAS number, including other names
3-Bromo-2-methyl-benzenesulfonyl chloride (CAS 886501-61-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024668-100MG |
| cas | 886501-61-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 4813.95 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-2-methylbenzenesulfonyl chloride (CAS 886501-61-7) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-bromo-2-methylbenzenesulfonyl chloride. InChIKey: LJQINJOCKBNGAJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-bromo-2-methylbenzenesulfonyl chloride |
| InChIKey | LJQINJOCKBNGAJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)