cas: 1029145-99-0 — see every product listed under this CAS number, including other names
3-Bromo-4-methyl-benzenesulfonyl chloride (CAS 1029145-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475749-250MG |
| cas | 1029145-99-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1549.47 Pln | |
| Fluorochem | 1g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
3-bromo-4-methylbenzenesulfonyl chloride (CAS 1029145-99-0) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-bromo-4-methylbenzenesulfonyl chloride. InChIKey: WAABTFILMSXGKZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-bromo-4-methylbenzenesulfonyl chloride |
| InChIKey | WAABTFILMSXGKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)