3-Carbamoyl-5-chloro-4-hydroxybenzenesulfonyl chloride, 98%
cas: 2132397-60-3 — see every product listed under this CAS number, including other names
3-Carbamoyl-5-chloro-4-hydroxybenzenesulfonyl chloride, 98% (CAS 2132397-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1F2C8K-100mg |
| cas | 2132397-60-3 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 3962.00 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 1778.56 Pln | |
| Fluorochem | 5g | 5178.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-carbamoyl-5-chloro-4-hydroxybenzenesulfonyl chloride (CAS 2132397-60-3) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 3-carbamoyl-5-chloro-4-hydroxybenzenesulfonyl chloride. InChIKey: BPLVQOKGEKBZLS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 3-carbamoyl-5-chloro-4-hydroxybenzenesulfonyl chloride |
| InChIKey | BPLVQOKGEKBZLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)