CAS 338962-58-6 is the registry number for 2-((3,5-Dichloro-2-pyridinyl)sulfonyl)acetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid (CAS 338962-58-6) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid. InChIKey: KVNKMVWBPSKPEO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid |
| InChIKey | KVNKMVWBPSKPEO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)S(=O)(=O)CC(=O)O)Cl |
Computed by PubChem (NCBI)