Products 869965-83-3
CAS 869965-83-3 appears in our catalog under these names: 2,3-Dichloro-5-sulfamoylbenzoic acid, 95%, 2,3-Dichloro-5-sulfamoylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2,3-dichloro-5-sulfamoylbenzoic acid (CAS 869965-83-3) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 2,3-dichloro-5-sulfamoylbenzoic acid. InChIKey: LTFKNFZNUVHONC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 2,3-dichloro-5-sulfamoylbenzoic acid |
| InChIKey | LTFKNFZNUVHONC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)