Products 80-13-7
CAS 80-13-7 appears in our catalog under these names: halazon, 95%, Halazone, Halazone, 90%, 90%, Halazone, 75.0%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 100mg, 250mg, 50mg, 50 mg, 100 mg, 250 mg.
4-(dichlorosulfamoyl)benzoic acid (CAS 80-13-7) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 4-(dichlorosulfamoyl)benzoic acid. InChIKey: XPDVQPODLRGWPL-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 4-(dichlorosulfamoyl)benzoic acid |
| InChIKey | XPDVQPODLRGWPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)N(Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
halazone, Halazon, Pantocide, 4-(Dichlorosulfamoyl)benzoic Acid, Cloritines, Pantosid, Pantotsid, Pentocid, Zeptabs, Halazono