Products 62971-57-7
CAS 62971-57-7 appears in our catalog under these names: Furosemide Impurity 22, Furosemide Impurity 68. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-5-sulfamoylbenzoic acid (CAS 62971-57-7) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 3,4-dichloro-5-sulfamoylbenzoic acid. InChIKey: KZGNROXSHPSJSN-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 3,4-dichloro-5-sulfamoylbenzoic acid |
| InChIKey | KZGNROXSHPSJSN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1S(=O)(=O)N)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)